C18H32N2O4 — CID 157039292
2-cyclohexyl-4-[(3,4,5-trihydroxypiperidin-1-yl)methyl]piperidine-1-carbaldehyde (PubChem CID 157039292) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is 2-cyclohexyl-4-[(3,4,5-trihydroxypiperidin-1-yl)methyl]piperidine-1-carbaldehyde.
| Compound Name | 2-cyclohexyl-4-[(3,4,5-trihydroxypiperidin-1-yl)methyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 157039292 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-cyclohexyl-4-[(3,4,5-trihydroxypiperidin-1-yl)methyl]piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(CN2CC(O)C(O)C(O)C2)CC1C1CCCCC1 |
| InChI | InChI=1S/C18H32N2O4/c21-12-20-7-6-13(8-15(20)14-4-2-1-3-5-14)9-19-10-16(22)18(24)17(23)11-19/h12-18,22-24H,1-11H2 |
| InChIKey | KDFNPTITRZBYRF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|