C15H27NO2 — CID 129404445
(3aS,5R,6R,7aS)-2-(piperidin-1-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-5,6-diol (PubChem CID 129404445) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (3aS,5R,6R,7aS)-2-(piperidin-1-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-5,6-diol.
| Compound Name | (3aS,5R,6R,7aS)-2-(piperidin-1-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-5,6-diol |
|---|---|
| PubChem CID | 129404445 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (3aS,5R,6R,7aS)-2-(piperidin-1-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene-5,6-diol |
| SMILES | O[C@@H]1C[C@@H]2CC(CN3CCCCC3)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C15H27NO2/c17-14-8-12-6-11(7-13(12)9-15(14)18)10-16-4-2-1-3-5-16/h11-15,17-18H,1-10H2/t12-,13-,14+,15+/m0/s1 |
| InChIKey | SUPFCBRWWMOFQN-BYNSBNAKSA-N |
| XLogP | 1.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |