About 1-(cyclohexylmethyl)piperidine;ethane;ethanol
1-(cyclohexylmethyl)piperidine;ethane;ethanol (PubChem CID 143571293) has the molecular formula C16H35NO
and a molecular weight of 257.46 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)piperidine;ethane;ethanol.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)piperidine;ethane;ethanol |
| PubChem CID | 143571293 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | 1-(cyclohexylmethyl)piperidine;ethane;ethanol |
| SMILES | C1CCC(CN2CCCCC2)CC1.CC.CCO |
| InChI | InChI=1S/C12H23N.C2H6O.C2H6/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2-3;1-2/h12H,1-11H2;3H,2H2,1H3;1-2H3 |
| InChIKey | VFXXZSRXRWGUPA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclohexylmethyl)piperidine;ethane;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)piperidine;ethane;ethanol?
The IUPAC name of 1-(cyclohexylmethyl)piperidine;ethane;ethanol (CID 143571293) is 1-(cyclohexylmethyl)piperidine;ethane;ethanol.
What is the SMILES notation for 1-(cyclohexylmethyl)piperidine;ethane;ethanol?
The canonical SMILES for 1-(cyclohexylmethyl)piperidine;ethane;ethanol is C1CCC(CN2CCCCC2)CC1.CC.CCO.
What is the InChIKey of 1-(cyclohexylmethyl)piperidine;ethane;ethanol?
The InChIKey is VFXXZSRXRWGUPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C2H6O.C2H6/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2-3;1-2/h12H,1-11H2;3H,2H2,1H3;1-2H3.
What are the key properties of 1-(cyclohexylmethyl)piperidine;ethane;ethanol?
1-(cyclohexylmethyl)piperidine;ethane;ethanol has a molecular weight of 257.46 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)piperidine;ethane;ethanol is sourced from PubChem (CID 143571293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).