About 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne
1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne (PubChem CID 143571161) has the molecular formula C17H33NO
and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne |
| PubChem CID | 143571161 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne |
| SMILES | C#CC.C1CCC(CN2CCCCC2)CC1.CCO |
| InChI | InChI=1S/C12H23N.C3H4.C2H6O/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-3-2;1-2-3/h12H,1-11H2;1H,2H3;3H,2H2,1H3 |
| InChIKey | ZIYSILMSMLORBO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne?
The IUPAC name of 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne (CID 143571161) is 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne.
What is the SMILES notation for 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne?
The canonical SMILES for 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne is C#CC.C1CCC(CN2CCCCC2)CC1.CCO.
What is the InChIKey of 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne?
The InChIKey is ZIYSILMSMLORBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C3H4.C2H6O/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-3-2;1-2-3/h12H,1-11H2;1H,2H3;3H,2H2,1H3.
What are the key properties of 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne?
1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne has a molecular weight of 267.46 g/mol, XLogP of 3.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)piperidine;ethanol;prop-1-yne is sourced from PubChem (CID 143571161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).