C19H33N — CID 142354921
1-(cyclohexylmethyl)-4-[(2Z,4E)-4-methylhexa-2,4-dien-3-yl]piperidine (PubChem CID 142354921) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-4-[(2Z,4E)-4-methylhexa-2,4-dien-3-yl]piperidine.
| Compound Name | 1-(cyclohexylmethyl)-4-[(2Z,4E)-4-methylhexa-2,4-dien-3-yl]piperidine |
|---|---|
| PubChem CID | 142354921 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 1-(cyclohexylmethyl)-4-[(2Z,4E)-4-methylhexa-2,4-dien-3-yl]piperidine |
| SMILES | C/C=C(C(\C)=C\C)/C1CCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H33N/c1-4-16(3)19(5-2)18-11-13-20(14-12-18)15-17-9-7-6-8-10-17/h4-5,17-18H,6-15H2,1-3H3/b16-4+,19-5+ |
| InChIKey | NZBTUPGMIBEALN-QLQDTXNKSA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|