About 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol
1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol (PubChem CID 157039193) has the molecular formula C13H24F3NO2
and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol |
| PubChem CID | 157039193 |
| Molecular Formula | C13H24F3NO2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol |
| SMILES | OC(F)(F)F.OC1CCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C12H23NO.CHF3O/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11;2-1(3,4)5/h11-12,14H,1-10H2;5H |
| InChIKey | LVISBJCIMIEHBX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol?
The IUPAC name of 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol (CID 157039193) is 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol.
What is the SMILES notation for 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol?
The canonical SMILES for 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol is OC(F)(F)F.OC1CCN(CC2CCCCC2)CC1.
What is the InChIKey of 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol?
The InChIKey is LVISBJCIMIEHBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO.CHF3O/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11;2-1(3,4)5/h11-12,14H,1-10H2;5H.
What are the key properties of 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol?
1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol has a molecular weight of 283.33 g/mol, XLogP of 2.52, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)piperidin-4-ol;trifluoromethanol is sourced from PubChem (CID 157039193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).