About 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane
1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane (PubChem CID 157039213) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane.
Molecular Properties
| Compound Name | 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane |
| PubChem CID | 157039213 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane |
| SMILES | C1CCCCC1.OC1CCN(CC2CNC2)CC1 |
| InChI | InChI=1S/C9H18N2O.C6H12/c12-9-1-3-11(4-2-9)7-8-5-10-6-8;1-2-4-6-5-3-1/h8-10,12H,1-7H2;1-6H2 |
| InChIKey | RKZWWBCPPWQTCY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane?
The IUPAC name of 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane (CID 157039213) is 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane.
What is the SMILES notation for 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane?
The canonical SMILES for 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane is C1CCCCC1.OC1CCN(CC2CNC2)CC1.
What is the InChIKey of 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane?
The InChIKey is RKZWWBCPPWQTCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C6H12/c12-9-1-3-11(4-2-9)7-8-5-10-6-8;1-2-4-6-5-3-1/h8-10,12H,1-7H2;1-6H2.
What are the key properties of 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane?
1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane has a molecular weight of 254.42 g/mol, XLogP of 2.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclohexane is sourced from PubChem (CID 157039213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).