C15H29N — CID 137427496
1-[[(3S)-3,6-dimethylcycloheptyl]methyl]piperidine (PubChem CID 137427496) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 1-[[(3S)-3,6-dimethylcycloheptyl]methyl]piperidine.
| Compound Name | 1-[[(3S)-3,6-dimethylcycloheptyl]methyl]piperidine |
|---|---|
| PubChem CID | 137427496 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 1-[[(3S)-3,6-dimethylcycloheptyl]methyl]piperidine |
| SMILES | CC1CC[C@H](C)CC(CN2CCCCC2)C1 |
| InChI | InChI=1S/C15H29N/c1-13-6-7-14(2)11-15(10-13)12-16-8-4-3-5-9-16/h13-15H,3-12H2,1-2H3/t13-,14?,15?/m0/s1 |
| InChIKey | PHHLSMFKMSTZIB-NFOMZHRRSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |