C16H29NO3 — CID 157039270
1-(spiro[4.5]decan-8-ylmethyl)piperidine-3,4,5-triol (PubChem CID 157039270) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 1-(spiro[4.5]decan-8-ylmethyl)piperidine-3,4,5-triol.
| Compound Name | 1-(spiro[4.5]decan-8-ylmethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039270 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 1-(spiro[4.5]decan-8-ylmethyl)piperidine-3,4,5-triol |
| SMILES | OC1CN(CC2CCC3(CCCC3)CC2)CC(O)C1O |
| InChI | InChI=1S/C16H29NO3/c18-13-10-17(11-14(19)15(13)20)9-12-3-7-16(8-4-12)5-1-2-6-16/h12-15,18-20H,1-11H2 |
| InChIKey | GYLIMOGXPDOWSK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |