C5H12N2O2 — CID 67191860
1-(aminomethyl)pyrrolidine-3,4-diol (PubChem CID 67191860) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is 1-(aminomethyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(aminomethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 67191860 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 1-(aminomethyl)pyrrolidine-3,4-diol |
| SMILES | NCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C5H12N2O2/c6-3-7-1-4(8)5(9)2-7/h4-5,8-9H,1-3,6H2 |
| InChIKey | NSXXZRMSDDBHIO-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |