C10H20FNO3 — CID 166293921
(3R,5S)-1-(3-fluoro-3-methylbutyl)piperidine-3,4,5-triol (PubChem CID 166293921) has the molecular formula C10H20FNO3 and a molecular weight of 221.27 g/mol. Its IUPAC name is (3R,5S)-1-(3-fluoro-3-methylbutyl)piperidine-3,4,5-triol.
| Compound Name | (3R,5S)-1-(3-fluoro-3-methylbutyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 166293921 |
| Molecular Formula | C10H20FNO3 |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3R,5S)-1-(3-fluoro-3-methylbutyl)piperidine-3,4,5-triol |
| SMILES | CC(C)(F)CCN1C[C@@H](O)C(O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H20FNO3/c1-10(2,11)3-4-12-5-7(13)9(15)8(14)6-12/h7-9,13-15H,3-6H2,1-2H3/t7-,8+,9? |
| InChIKey | VJLVXJFZQLTPFZ-JVHMLUBASA-N |
| XLogP | -0.48 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |