C9H19NO3 — CID 172518129
(3R,5S)-1-tert-butylpiperidine-3,4,5-triol (PubChem CID 172518129) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (3R,5S)-1-tert-butylpiperidine-3,4,5-triol.
| Compound Name | (3R,5S)-1-tert-butylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 172518129 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (3R,5S)-1-tert-butylpiperidine-3,4,5-triol |
| SMILES | CC(C)(C)N1C[C@@H](O)C(O)[C@@H](O)C1 |
| InChI | InChI=1S/C9H19NO3/c1-9(2,3)10-4-6(11)8(13)7(12)5-10/h6-8,11-13H,4-5H2,1-3H3/t6-,7+,8? |
| InChIKey | RZGGRBPEKFRUFP-DHBOJHSNSA-N |
| XLogP | -0.82 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |