C12H27NO — CID 161248171
(3R,4S)-1-tert-butyl-4-methylpiperidin-3-ol;ethane (PubChem CID 161248171) has the molecular formula C12H27NO and a molecular weight of 201.35 g/mol. Its IUPAC name is (3R,4S)-1-tert-butyl-4-methylpiperidin-3-ol;ethane.
| Compound Name | (3R,4S)-1-tert-butyl-4-methylpiperidin-3-ol;ethane |
|---|---|
| PubChem CID | 161248171 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | (3R,4S)-1-tert-butyl-4-methylpiperidin-3-ol;ethane |
| SMILES | CC.C[C@H]1CCN(C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C10H21NO.C2H6/c1-8-5-6-11(7-9(8)12)10(2,3)4;1-2/h8-9,12H,5-7H2,1-4H3;1-2H3/t8-,9-;/m0./s1 |
| InChIKey | VAXIFGLTFMZAKU-OZZZDHQUSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |