C9H20N2O — CID 90286839
(3R,4S)-3-amino-1-tert-butylpiperidin-4-ol (PubChem CID 90286839) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-tert-butylpiperidin-4-ol.
| Compound Name | (3R,4S)-3-amino-1-tert-butylpiperidin-4-ol |
|---|---|
| PubChem CID | 90286839 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (3R,4S)-3-amino-1-tert-butylpiperidin-4-ol |
| SMILES | CC(C)(C)N1CC[C@H](O)[C@H](N)C1 |
| InChI | InChI=1S/C9H20N2O/c1-9(2,3)11-5-4-8(12)7(10)6-11/h7-8,12H,4-6,10H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | LLLNISQBVGTWAX-SFYZADRCSA-N |
| XLogP | 0.18 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |