C17H37N3 — CID 159904713
(3S)-1-tert-butyl-3-methylpyrrolidine;(3S)-1-tert-butylpyrrolidin-3-amine (PubChem CID 159904713) has the molecular formula C17H37N3 and a molecular weight of 283.50 g/mol. Its IUPAC name is (3S)-1-tert-butyl-3-methylpyrrolidine;(3S)-1-tert-butylpyrrolidin-3-amine.
| Compound Name | (3S)-1-tert-butyl-3-methylpyrrolidine;(3S)-1-tert-butylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 159904713 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | (3S)-1-tert-butyl-3-methylpyrrolidine;(3S)-1-tert-butylpyrrolidin-3-amine |
| SMILES | CC(C)(C)N1CC[C@H](N)C1.C[C@H]1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C9H19N.C8H18N2/c1-8-5-6-10(7-8)9(2,3)4;1-8(2,3)10-5-4-7(9)6-10/h8H,5-7H2,1-4H3;7H,4-6,9H2,1-3H3/t8-;7-/m00/s1 |
| InChIKey | NWKOWPCVFJROGW-GZTXQBDSSA-N |
| XLogP | 2.94 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |