C16H35N3O — CID 159962975
4-tert-butylmorpholine;1-tert-butylpyrrolidin-3-amine (PubChem CID 159962975) has the molecular formula C16H35N3O and a molecular weight of 285.48 g/mol. Its IUPAC name is 4-tert-butylmorpholine;1-tert-butylpyrrolidin-3-amine.
| Compound Name | 4-tert-butylmorpholine;1-tert-butylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 159962975 |
| Molecular Formula | C16H35N3O |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.28 |
| IUPAC Name | 4-tert-butylmorpholine;1-tert-butylpyrrolidin-3-amine |
| SMILES | CC(C)(C)N1CCC(N)C1.CC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C8H18N2.C8H17NO/c1-8(2,3)10-5-4-7(9)6-10;1-8(2,3)9-4-6-10-7-5-9/h7H,4-6,9H2,1-3H3;4-7H2,1-3H3 |
| InChIKey | ODOKIOYRCXSUSV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |