About 4-tert-butylmorpholine;2-methoxy-2-methylpropane
4-tert-butylmorpholine;2-methoxy-2-methylpropane (PubChem CID 159275308) has the molecular formula C13H29NO2
and a molecular weight of 231.38 g/mol. Its IUPAC name is 4-tert-butylmorpholine;2-methoxy-2-methylpropane.
Molecular Properties
| Compound Name | 4-tert-butylmorpholine;2-methoxy-2-methylpropane |
| PubChem CID | 159275308 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | 4-tert-butylmorpholine;2-methoxy-2-methylpropane |
| SMILES | CC(C)(C)N1CCOCC1.COC(C)(C)C |
| InChI | InChI=1S/C8H17NO.C5H12O/c1-8(2,3)9-4-6-10-7-5-9;1-5(2,3)6-4/h4-7H2,1-3H3;1-4H3 |
| InChIKey | KYFRLFGCWARNQJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butylmorpholine;2-methoxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylmorpholine;2-methoxy-2-methylpropane?
The IUPAC name of 4-tert-butylmorpholine;2-methoxy-2-methylpropane (CID 159275308) is 4-tert-butylmorpholine;2-methoxy-2-methylpropane.
What is the SMILES notation for 4-tert-butylmorpholine;2-methoxy-2-methylpropane?
The canonical SMILES for 4-tert-butylmorpholine;2-methoxy-2-methylpropane is CC(C)(C)N1CCOCC1.COC(C)(C)C.
What is the InChIKey of 4-tert-butylmorpholine;2-methoxy-2-methylpropane?
The InChIKey is KYFRLFGCWARNQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C5H12O/c1-8(2,3)9-4-6-10-7-5-9;1-5(2,3)6-4/h4-7H2,1-3H3;1-4H3.
What are the key properties of 4-tert-butylmorpholine;2-methoxy-2-methylpropane?
4-tert-butylmorpholine;2-methoxy-2-methylpropane has a molecular weight of 231.38 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylmorpholine;2-methoxy-2-methylpropane is sourced from PubChem (CID 159275308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).