C14H26F3N — CID 170677204
1,4-ditert-butyl-3-(trifluoromethyl)piperidine (PubChem CID 170677204) has the molecular formula C14H26F3N and a molecular weight of 265.36 g/mol. Its IUPAC name is 1,4-ditert-butyl-3-(trifluoromethyl)piperidine.
| Compound Name | 1,4-ditert-butyl-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 170677204 |
| Molecular Formula | C14H26F3N |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 1,4-ditert-butyl-3-(trifluoromethyl)piperidine |
| SMILES | CC(C)(C)C1CCN(C(C)(C)C)CC1C(F)(F)F |
| InChI | InChI=1S/C14H26F3N/c1-12(2,3)10-7-8-18(13(4,5)6)9-11(10)14(15,16)17/h10-11H,7-9H2,1-6H3 |
| InChIKey | OXPAHGLBASUTHX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |