About (4S)-1,3-ditert-butyl-4-fluoropyrrolidine
(4S)-1,3-ditert-butyl-4-fluoropyrrolidine (PubChem CID 153470719) has the molecular formula C12H24FN
and a molecular weight of 201.33 g/mol. Its IUPAC name is (4S)-1,3-ditert-butyl-4-fluoropyrrolidine.
Molecular Properties
| Compound Name | (4S)-1,3-ditert-butyl-4-fluoropyrrolidine |
| PubChem CID | 153470719 |
| Molecular Formula | C12H24FN |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | (4S)-1,3-ditert-butyl-4-fluoropyrrolidine |
| SMILES | CC(C)(C)C1CN(C(C)(C)C)C[C@H]1F |
| InChI | InChI=1S/C12H24FN/c1-11(2,3)9-7-14(8-10(9)13)12(4,5)6/h9-10H,7-8H2,1-6H3/t9?,10-/m1/s1 |
| InChIKey | IPPLCGCPXFVSOY-QVDQXJPCSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-1,3-ditert-butyl-4-fluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1,3-ditert-butyl-4-fluoropyrrolidine?
The IUPAC name of (4S)-1,3-ditert-butyl-4-fluoropyrrolidine (CID 153470719) is (4S)-1,3-ditert-butyl-4-fluoropyrrolidine.
What is the SMILES notation for (4S)-1,3-ditert-butyl-4-fluoropyrrolidine?
The canonical SMILES for (4S)-1,3-ditert-butyl-4-fluoropyrrolidine is CC(C)(C)C1CN(C(C)(C)C)C[C@H]1F.
What is the InChIKey of (4S)-1,3-ditert-butyl-4-fluoropyrrolidine?
The InChIKey is IPPLCGCPXFVSOY-QVDQXJPCSA-N. The full InChI is InChI=1S/C12H24FN/c1-11(2,3)9-7-14(8-10(9)13)12(4,5)6/h9-10H,7-8H2,1-6H3/t9?,10-/m1/s1.
What are the key properties of (4S)-1,3-ditert-butyl-4-fluoropyrrolidine?
(4S)-1,3-ditert-butyl-4-fluoropyrrolidine has a molecular weight of 201.33 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1,3-ditert-butyl-4-fluoropyrrolidine is sourced from PubChem (CID 153470719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).