C39H75N3O3 — CID 139039444
(1R,6S)-8-tert-butyl-8-azabicyclo[4.3.1]decan-10-ol (PubChem CID 139039444) has the molecular formula C39H75N3O3 and a molecular weight of 634.05 g/mol. Its IUPAC name is (1R,6S)-8-tert-butyl-8-azabicyclo[4.3.1]decan-10-ol.
| Compound Name | (1R,6S)-8-tert-butyl-8-azabicyclo[4.3.1]decan-10-ol |
|---|---|
| PubChem CID | 139039444 |
| Molecular Formula | C39H75N3O3 |
| Molecular Weight | 634.05 g/mol |
| Exact Mass | 633.58 |
| IUPAC Name | (1R,6S)-8-tert-butyl-8-azabicyclo[4.3.1]decan-10-ol |
| SMILES | CC(C)(C)N1C[C@H]2CCCC[C@@H](C1)C2O.CC(C)(C)N1C[C@H]2CCCC[C@@H](C1)C2O.CC(C)(C)N1C[C@H]2CCCC[C@@H](C1)C2O |
| InChI | InChI=1S/3C13H25NO/c3*1-13(2,3)14-8-10-6-4-5-7-11(9-14)12(10)15/h3*10-12,15H,4-9H2,1-3H3/t3*10-,11+,12? |
| InChIKey | FIASZUWNXDOAAR-YWCCBNIDSA-N |
| XLogP | 6.80 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.05 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |