C14H27N — CID 177091960
(4aR,9aS)-2-tert-butyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine (PubChem CID 177091960) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (4aR,9aS)-2-tert-butyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine.
| Compound Name | (4aR,9aS)-2-tert-butyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine |
|---|---|
| PubChem CID | 177091960 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (4aR,9aS)-2-tert-butyl-1,3,4,4a,5,6,7,8,9,9a-decahydrocyclohepta[c]pyridine |
| SMILES | CC(C)(C)N1CC[C@H]2CCCCC[C@@H]2C1 |
| InChI | InChI=1S/C14H27N/c1-14(2,3)15-10-9-12-7-5-4-6-8-13(12)11-15/h12-13H,4-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | LPVNLHBRNAXVAS-CHWSQXEVSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |