C11H23NO3 — CID 172518164
(3R,4R,5R)-1-tert-butyl-5-(methoxymethyl)piperidine-3,4-diol (PubChem CID 172518164) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is (3R,4R,5R)-1-tert-butyl-5-(methoxymethyl)piperidine-3,4-diol.
| Compound Name | (3R,4R,5R)-1-tert-butyl-5-(methoxymethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 172518164 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | (3R,4R,5R)-1-tert-butyl-5-(methoxymethyl)piperidine-3,4-diol |
| SMILES | COC[C@H]1CN(C(C)(C)C)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H23NO3/c1-11(2,3)12-5-8(7-15-4)10(14)9(13)6-12/h8-10,13-14H,5-7H2,1-4H3/t8-,9-,10-/m1/s1 |
| InChIKey | WIXVHHRAUKRXSB-OPRDCNLKSA-N |
| XLogP | 0.08 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |