C7H15NO2 — CID 140507745
(3R,4R)-4-(methoxymethyl)-1-methylpyrrolidin-3-ol (PubChem CID 140507745) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is (3R,4R)-4-(methoxymethyl)-1-methylpyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-(methoxymethyl)-1-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 140507745 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (3R,4R)-4-(methoxymethyl)-1-methylpyrrolidin-3-ol |
| SMILES | COC[C@H]1CN(C)C[C@@H]1O |
| InChI | InChI=1S/C7H15NO2/c1-8-3-6(5-10-2)7(9)4-8/h6-7,9H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | NZQBGDSCSPWZRD-RQJHMYQMSA-N |
| XLogP | -0.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |