About (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane
(4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane (PubChem CID 177212700) has the molecular formula C9H18F3N
and a molecular weight of 197.24 g/mol. Its IUPAC name is (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane.
Molecular Properties
| Compound Name | (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane |
| PubChem CID | 177212700 |
| Molecular Formula | C9H18F3N |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane |
| SMILES | CC.C[C@H]1CN(CC(F)F)CC1F |
| InChI | InChI=1S/C7H12F3N.C2H6/c1-5-2-11(3-6(5)8)4-7(9)10;1-2/h5-7H,2-4H2,1H3;1-2H3/t5-,6?;/m0./s1 |
| InChIKey | UPRYZPGKBAMMHJ-GNVLWMSISA-N |
| XLogP | 2.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane?
The IUPAC name of (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane (CID 177212700) is (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane.
What is the SMILES notation for (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane?
The canonical SMILES for (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane is CC.C[C@H]1CN(CC(F)F)CC1F.
What is the InChIKey of (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane?
The InChIKey is UPRYZPGKBAMMHJ-GNVLWMSISA-N. The full InChI is InChI=1S/C7H12F3N.C2H6/c1-5-2-11(3-6(5)8)4-7(9)10;1-2/h5-7H,2-4H2,1H3;1-2H3/t5-,6?;/m0./s1.
What are the key properties of (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane?
(4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane has a molecular weight of 197.24 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-(2,2-difluoroethyl)-3-fluoro-4-methylpyrrolidine;ethane is sourced from PubChem (CID 177212700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).