C10H20F2N2 — CID 115408499
1-(2,2-difluoroethyl)-3,7-dimethyl-1,5-diazocane (PubChem CID 115408499) has the molecular formula C10H20F2N2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3,7-dimethyl-1,5-diazocane.
| Compound Name | 1-(2,2-difluoroethyl)-3,7-dimethyl-1,5-diazocane |
|---|---|
| PubChem CID | 115408499 |
| Molecular Formula | C10H20F2N2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3,7-dimethyl-1,5-diazocane |
| SMILES | CC1CNCC(C)CN(CC(F)F)C1 |
| InChI | InChI=1S/C10H20F2N2/c1-8-3-13-4-9(2)6-14(5-8)7-10(11)12/h8-10,13H,3-7H2,1-2H3 |
| InChIKey | MLCJZWDUMPWVLO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |