C11H20F2N2 — CID 126573560
4-(azetidin-3-ylmethyl)-1-(2,2-difluoroethyl)piperidine (PubChem CID 126573560) has the molecular formula C11H20F2N2 and a molecular weight of 218.29 g/mol. Its IUPAC name is 4-(azetidin-3-ylmethyl)-1-(2,2-difluoroethyl)piperidine.
| Compound Name | 4-(azetidin-3-ylmethyl)-1-(2,2-difluoroethyl)piperidine |
|---|---|
| PubChem CID | 126573560 |
| Molecular Formula | C11H20F2N2 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 4-(azetidin-3-ylmethyl)-1-(2,2-difluoroethyl)piperidine |
| SMILES | FC(F)CN1CCC(CC2CNC2)CC1 |
| InChI | InChI=1S/C11H20F2N2/c12-11(13)8-15-3-1-9(2-4-15)5-10-6-14-7-10/h9-11,14H,1-8H2 |
| InChIKey | MNJGXDDJASGHHN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |