About 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane
6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane (PubChem CID 130685379) has the molecular formula C8H13F2N
and a molecular weight of 161.19 g/mol. Its IUPAC name is 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane.
Analyze 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane?
The IUPAC name of 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane (CID 130685379) is 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane.
What is the SMILES notation for 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane?
The canonical SMILES for 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane is FC(F)CN1CC2CCCC21.
What is the InChIKey of 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane?
The InChIKey is KBZJXFUSYOIXDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2N/c9-8(10)5-11-4-6-2-1-3-7(6)11/h6-8H,1-5H2.
What are the key properties of 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane?
6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane has a molecular weight of 161.19 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-difluoroethyl)-6-azabicyclo[3.2.0]heptane is sourced from PubChem (CID 130685379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).