C9H20Cl2N2 — CID 122669519
(2R)-1-(6-azabicyclo[3.2.0]heptan-6-yl)propan-2-amine;dihydrochloride (PubChem CID 122669519) has the molecular formula C9H20Cl2N2 and a molecular weight of 227.18 g/mol. Its IUPAC name is (2R)-1-(6-azabicyclo[3.2.0]heptan-6-yl)propan-2-amine;dihydrochloride.
| Compound Name | (2R)-1-(6-azabicyclo[3.2.0]heptan-6-yl)propan-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 122669519 |
| Molecular Formula | C9H20Cl2N2 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (2R)-1-(6-azabicyclo[3.2.0]heptan-6-yl)propan-2-amine;dihydrochloride |
| SMILES | C[C@@H](N)CN1CC2CCCC21.Cl.Cl |
| InChI | InChI=1S/C9H18N2.2ClH/c1-7(10)5-11-6-8-3-2-4-9(8)11;;/h7-9H,2-6,10H2,1H3;2*1H/t7-,8?,9?;;/m1../s1 |
| InChIKey | IKPKERGJVCDCSC-PGBYRUPHSA-N |
| XLogP | 1.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |