C11H21ClN2O — CID 130762788
(2R)-2-amino-1-(6-azabicyclo[3.2.0]heptan-6-yl)-3-methylbutan-1-one;hydrochloride (PubChem CID 130762788) has the molecular formula C11H21ClN2O and a molecular weight of 232.75 g/mol. Its IUPAC name is (2R)-2-amino-1-(6-azabicyclo[3.2.0]heptan-6-yl)-3-methylbutan-1-one;hydrochloride.
| Compound Name | (2R)-2-amino-1-(6-azabicyclo[3.2.0]heptan-6-yl)-3-methylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 130762788 |
| Molecular Formula | C11H21ClN2O |
| Molecular Weight | 232.75 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2R)-2-amino-1-(6-azabicyclo[3.2.0]heptan-6-yl)-3-methylbutan-1-one;hydrochloride |
| SMILES | CC(C)[C@@H](N)C(=O)N1CC2CCCC21.Cl |
| InChI | InChI=1S/C11H20N2O.ClH/c1-7(2)10(12)11(14)13-6-8-4-3-5-9(8)13;/h7-10H,3-6,12H2,1-2H3;1H/t8?,9?,10-;/m1./s1 |
| InChIKey | VOCBNSXFLIPXRC-ZSZPEYCFSA-N |
| XLogP | 1.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.75 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |