C11H19NOS — CID 107031197
1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-sulfanylpropan-1-one (PubChem CID 107031197) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-sulfanylpropan-1-one.
| Compound Name | 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 107031197 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-sulfanylpropan-1-one |
| SMILES | CC(S)C(=O)N1CCCC2CCCC21 |
| InChI | InChI=1S/C11H19NOS/c1-8(14)11(13)12-7-3-5-9-4-2-6-10(9)12/h8-10,14H,2-7H2,1H3 |
| InChIKey | ZDFRUHJYFMDRMP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|