C12H23ClN2O — CID 119300932
(2S)-2-amino-1-(2-cyclopentylpyrrolidin-1-yl)propan-1-one;hydrochloride (PubChem CID 119300932) has the molecular formula C12H23ClN2O and a molecular weight of 246.78 g/mol. Its IUPAC name is (2S)-2-amino-1-(2-cyclopentylpyrrolidin-1-yl)propan-1-one;hydrochloride.
| Compound Name | (2S)-2-amino-1-(2-cyclopentylpyrrolidin-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119300932 |
| Molecular Formula | C12H23ClN2O |
| Molecular Weight | 246.78 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2S)-2-amino-1-(2-cyclopentylpyrrolidin-1-yl)propan-1-one;hydrochloride |
| SMILES | C[C@H](N)C(=O)N1CCCC1C1CCCC1.Cl |
| InChI | InChI=1S/C12H22N2O.ClH/c1-9(13)12(15)14-8-4-7-11(14)10-5-2-3-6-10;/h9-11H,2-8,13H2,1H3;1H/t9-,11?;/m0./s1 |
| InChIKey | DEPOSGXOGXOGNN-QMOSYVFLSA-N |
| XLogP | 1.94 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.78 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |