C9H17N — CID 130709044
(1R,6R)-7-ethyl-7-azabicyclo[4.2.0]octane (PubChem CID 130709044) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (1R,6R)-7-ethyl-7-azabicyclo[4.2.0]octane.
| Compound Name | (1R,6R)-7-ethyl-7-azabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 130709044 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (1R,6R)-7-ethyl-7-azabicyclo[4.2.0]octane |
| SMILES | CCN1C[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C9H17N/c1-2-10-7-8-5-3-4-6-9(8)10/h8-9H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | DZGWSAXHLGVNRU-RKDXNWHRSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |