C11H21NO — CID 130627677
4-ethyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 130627677) has the molecular formula C11H21NO and a molecular weight of 183.30 g/mol. Its IUPAC name is 4-ethyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | 4-ethyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 130627677 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 4-ethyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | CCN1CC(C)OC2CCCCC21 |
| InChI | InChI=1S/C11H21NO/c1-3-12-8-9(2)13-11-7-5-4-6-10(11)12/h9-11H,3-8H2,1-2H3 |
| InChIKey | KDACEXXAILQGHF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |