C9H18N2 — CID 155044597
2,6-diethyl-2,6-diazabicyclo[3.2.0]heptane (PubChem CID 155044597) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2,6-diethyl-2,6-diazabicyclo[3.2.0]heptane.
| Compound Name | 2,6-diethyl-2,6-diazabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 155044597 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2,6-diethyl-2,6-diazabicyclo[3.2.0]heptane |
| SMILES | CCN1CCC2C1CN2CC |
| InChI | InChI=1S/C9H18N2/c1-3-10-6-5-8-9(10)7-11(8)4-2/h8-9H,3-7H2,1-2H3 |
| InChIKey | KSEMXVKTNHFZMU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |