C6H11Br2N — CID 70422899
2,3-dibromo-1-ethylpyrrolidine (PubChem CID 70422899) has the molecular formula C6H11Br2N and a molecular weight of 256.97 g/mol. Its IUPAC name is 2,3-dibromo-1-ethylpyrrolidine.
| Compound Name | 2,3-dibromo-1-ethylpyrrolidine |
|---|---|
| PubChem CID | 70422899 |
| Molecular Formula | C6H11Br2N |
| Molecular Weight | 256.97 g/mol |
| Exact Mass | 254.93 |
| IUPAC Name | 2,3-dibromo-1-ethylpyrrolidine |
| SMILES | CCN1CCC(Br)C1Br |
| InChI | InChI=1S/C6H11Br2N/c1-2-9-4-3-5(7)6(9)8/h5-6H,2-4H2,1H3 |
| InChIKey | ANJWVTQNYUQHAK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.97 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|