C9H20FN — CID 175583829
1,3-diethyl-2-methylpyrrolidine;hydrofluoride (PubChem CID 175583829) has the molecular formula C9H20FN and a molecular weight of 161.26 g/mol. Its IUPAC name is 1,3-diethyl-2-methylpyrrolidine;hydrofluoride.
| Compound Name | 1,3-diethyl-2-methylpyrrolidine;hydrofluoride |
|---|---|
| PubChem CID | 175583829 |
| Molecular Formula | C9H20FN |
| Molecular Weight | 161.26 g/mol |
| Exact Mass | 161.16 |
| IUPAC Name | 1,3-diethyl-2-methylpyrrolidine;hydrofluoride |
| SMILES | CCC1CCN(CC)C1C.F |
| InChI | InChI=1S/C9H19N.FH/c1-4-9-6-7-10(5-2)8(9)3;/h8-9H,4-7H2,1-3H3;1H |
| InChIKey | FMSWITXXEZIQLE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |