C11H24N2 — CID 145162242
2,5-diethyl-2,5-diazabicyclo[2.2.1]heptane;ethane (PubChem CID 145162242) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 2,5-diethyl-2,5-diazabicyclo[2.2.1]heptane;ethane.
| Compound Name | 2,5-diethyl-2,5-diazabicyclo[2.2.1]heptane;ethane |
|---|---|
| PubChem CID | 145162242 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 2,5-diethyl-2,5-diazabicyclo[2.2.1]heptane;ethane |
| SMILES | CC.CCN1CC2CC1CN2CC |
| InChI | InChI=1S/C9H18N2.C2H6/c1-3-10-6-9-5-8(10)7-11(9)4-2;1-2/h8-9H,3-7H2,1-2H3;1-2H3 |
| InChIKey | VSAVTEAVBDPGRP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |