About butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one
butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one (PubChem CID 168923287) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one.
Molecular Properties
| Compound Name | butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one |
| PubChem CID | 168923287 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one |
| SMILES | CCCC.CCN1C[C@H]2CC1CN2C(=O)C(C)C |
| InChI | InChI=1S/C11H20N2O.C4H10/c1-4-12-6-10-5-9(12)7-13(10)11(14)8(2)3;1-3-4-2/h8-10H,4-7H2,1-3H3;3-4H2,1-2H3/t9?,10-;/m1./s1 |
| InChIKey | NBQLKRGUCNZWQO-FJYJDOHQSA-N |
| XLogP | 2.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one?
The IUPAC name of butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one (CID 168923287) is butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one.
What is the SMILES notation for butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one?
The canonical SMILES for butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one is CCCC.CCN1C[C@H]2CC1CN2C(=O)C(C)C.
What is the InChIKey of butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one?
The InChIKey is NBQLKRGUCNZWQO-FJYJDOHQSA-N. The full InChI is InChI=1S/C11H20N2O.C4H10/c1-4-12-6-10-5-9(12)7-13(10)11(14)8(2)3;1-3-4-2/h8-10H,4-7H2,1-3H3;3-4H2,1-2H3/t9?,10-;/m1./s1.
What are the key properties of butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one?
butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one has a molecular weight of 254.42 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-[(1R)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-1-one is sourced from PubChem (CID 168923287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).