C13H24IN3 — CID 165137131
(1S,4S)-2-ethyl-5-[(1-iodopiperidin-4-yl)methyl]-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 165137131) has the molecular formula C13H24IN3 and a molecular weight of 349.26 g/mol. Its IUPAC name is (1S,4S)-2-ethyl-5-[(1-iodopiperidin-4-yl)methyl]-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2-ethyl-5-[(1-iodopiperidin-4-yl)methyl]-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 165137131 |
| Molecular Formula | C13H24IN3 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (1S,4S)-2-ethyl-5-[(1-iodopiperidin-4-yl)methyl]-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CCN1C[C@@H]2C[C@H]1CN2CC1CCN(I)CC1 |
| InChI | InChI=1S/C13H24IN3/c1-2-15-9-13-7-12(15)10-16(13)8-11-3-5-17(14)6-4-11/h11-13H,2-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | JARXZDQHWCWKBG-STQMWFEESA-N |
| XLogP | 1.83 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|