About 4-cyclooctyl-1,3-diethylimidazolidine
4-cyclooctyl-1,3-diethylimidazolidine (PubChem CID 123302186) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is 4-cyclooctyl-1,3-diethylimidazolidine.
Molecular Properties
| Compound Name | 4-cyclooctyl-1,3-diethylimidazolidine |
| PubChem CID | 123302186 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 4-cyclooctyl-1,3-diethylimidazolidine |
| SMILES | CCN1CC(C2CCCCCCC2)N(CC)C1 |
| InChI | InChI=1S/C15H30N2/c1-3-16-12-15(17(4-2)13-16)14-10-8-6-5-7-9-11-14/h14-15H,3-13H2,1-2H3 |
| InChIKey | OEESKOYFROCHIO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclooctyl-1,3-diethylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclooctyl-1,3-diethylimidazolidine?
The IUPAC name of 4-cyclooctyl-1,3-diethylimidazolidine (CID 123302186) is 4-cyclooctyl-1,3-diethylimidazolidine.
What is the SMILES notation for 4-cyclooctyl-1,3-diethylimidazolidine?
The canonical SMILES for 4-cyclooctyl-1,3-diethylimidazolidine is CCN1CC(C2CCCCCCC2)N(CC)C1.
What is the InChIKey of 4-cyclooctyl-1,3-diethylimidazolidine?
The InChIKey is OEESKOYFROCHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2/c1-3-16-12-15(17(4-2)13-16)14-10-8-6-5-7-9-11-14/h14-15H,3-13H2,1-2H3.
What are the key properties of 4-cyclooctyl-1,3-diethylimidazolidine?
4-cyclooctyl-1,3-diethylimidazolidine has a molecular weight of 238.42 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclooctyl-1,3-diethylimidazolidine is sourced from PubChem (CID 123302186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).