C15H30N2 — CID 123302186
4-cyclooctyl-1,3-diethylimidazolidine (PubChem CID 123302186) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 4-cyclooctyl-1,3-diethylimidazolidine.
| Compound Name | 4-cyclooctyl-1,3-diethylimidazolidine |
|---|---|
| PubChem CID | 123302186 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 4-cyclooctyl-1,3-diethylimidazolidine |
| SMILES | CCN1CC(C2CCCCCCC2)N(CC)C1 |
| InChI | InChI=1S/C15H30N2/c1-3-16-12-15(17(4-2)13-16)14-10-8-6-5-7-9-11-14/h14-15H,3-13H2,1-2H3 |
| InChIKey | OEESKOYFROCHIO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |