About ethane;1-ethyl-3-methylazepane
ethane;1-ethyl-3-methylazepane (PubChem CID 142283412) has the molecular formula C11H25N
and a molecular weight of 171.33 g/mol. Its IUPAC name is ethane;1-ethyl-3-methylazepane.
Molecular Properties
| Compound Name | ethane;1-ethyl-3-methylazepane |
| PubChem CID | 142283412 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | ethane;1-ethyl-3-methylazepane |
| SMILES | CC.CCN1CCCCC(C)C1 |
| InChI | InChI=1S/C9H19N.C2H6/c1-3-10-7-5-4-6-9(2)8-10;1-2/h9H,3-8H2,1-2H3;1-2H3 |
| InChIKey | NLONZKKLZHHAKS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-ethyl-3-methylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-3-methylazepane?
The IUPAC name of ethane;1-ethyl-3-methylazepane (CID 142283412) is ethane;1-ethyl-3-methylazepane.
What is the SMILES notation for ethane;1-ethyl-3-methylazepane?
The canonical SMILES for ethane;1-ethyl-3-methylazepane is CC.CCN1CCCCC(C)C1.
What is the InChIKey of ethane;1-ethyl-3-methylazepane?
The InChIKey is NLONZKKLZHHAKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C2H6/c1-3-10-7-5-4-6-9(2)8-10;1-2/h9H,3-8H2,1-2H3;1-2H3.
What are the key properties of ethane;1-ethyl-3-methylazepane?
ethane;1-ethyl-3-methylazepane has a molecular weight of 171.33 g/mol, XLogP of 3.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-3-methylazepane is sourced from PubChem (CID 142283412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).