C12H26N2 — CID 123857151
N,N-diethyl-2-(3-methylpiperidin-1-yl)ethanamine (PubChem CID 123857151) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is N,N-diethyl-2-(3-methylpiperidin-1-yl)ethanamine.
| Compound Name | N,N-diethyl-2-(3-methylpiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 123857151 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N,N-diethyl-2-(3-methylpiperidin-1-yl)ethanamine |
| SMILES | CCN(CC)CCN1CCCC(C)C1 |
| InChI | InChI=1S/C12H26N2/c1-4-13(5-2)9-10-14-8-6-7-12(3)11-14/h12H,4-11H2,1-3H3 |
| InChIKey | ZDNCDOKVDVKELD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |