C15H36N2 — CID 176694882
N,N-diethyl-2-piperidin-1-ylethanamine;ethane (PubChem CID 176694882) has the molecular formula C15H36N2 and a molecular weight of 244.47 g/mol. Its IUPAC name is N,N-diethyl-2-piperidin-1-ylethanamine;ethane.
| Compound Name | N,N-diethyl-2-piperidin-1-ylethanamine;ethane |
|---|---|
| PubChem CID | 176694882 |
| Molecular Formula | C15H36N2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.29 |
| IUPAC Name | N,N-diethyl-2-piperidin-1-ylethanamine;ethane |
| SMILES | CC.CC.CCN(CC)CCN1CCCCC1 |
| InChI | InChI=1S/C11H24N2.2C2H6/c1-3-12(4-2)10-11-13-8-6-5-7-9-13;2*1-2/h3-11H2,1-2H3;2*1-2H3 |
| InChIKey | YAPFIVULPAKGPK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |