C15H34N2P2 — CID 101431965
N,N-bis(diethylphosphanyl)-2-piperidin-1-ylethanamine (PubChem CID 101431965) has the molecular formula C15H34N2P2 and a molecular weight of 304.40 g/mol. Its IUPAC name is N,N-bis(diethylphosphanyl)-2-piperidin-1-ylethanamine.
| Compound Name | N,N-bis(diethylphosphanyl)-2-piperidin-1-ylethanamine |
|---|---|
| PubChem CID | 101431965 |
| Molecular Formula | C15H34N2P2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N,N-bis(diethylphosphanyl)-2-piperidin-1-ylethanamine |
| SMILES | CCP(CC)N(CCN1CCCCC1)P(CC)CC |
| InChI | InChI=1S/C15H34N2P2/c1-5-18(6-2)17(19(7-3)8-4)15-14-16-12-10-9-11-13-16/h5-15H2,1-4H3 |
| InChIKey | BCLWYWBUXWMAIW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|