C13H27BrN2 — CID 107913841
2-[3-(2-bromoethyl)piperidin-1-yl]-N,N-diethylethanamine (PubChem CID 107913841) has the molecular formula C13H27BrN2 and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-[3-(2-bromoethyl)piperidin-1-yl]-N,N-diethylethanamine.
| Compound Name | 2-[3-(2-bromoethyl)piperidin-1-yl]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 107913841 |
| Molecular Formula | C13H27BrN2 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-[3-(2-bromoethyl)piperidin-1-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCN1CCCC(CCBr)C1 |
| InChI | InChI=1S/C13H27BrN2/c1-3-15(4-2)10-11-16-9-5-6-13(12-16)7-8-14/h13H,3-12H2,1-2H3 |
| InChIKey | YNDZBUBJHZFFID-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|