C12H21BrF3NO — CID 80690484
3-(2-bromoethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine (PubChem CID 80690484) has the molecular formula C12H21BrF3NO and a molecular weight of 332.20 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine.
| Compound Name | 3-(2-bromoethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine |
|---|---|
| PubChem CID | 80690484 |
| Molecular Formula | C12H21BrF3NO |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 3-(2-bromoethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine |
| SMILES | FC(F)(F)COCCCN1CCCC(CCBr)C1 |
| InChI | InChI=1S/C12H21BrF3NO/c13-5-4-11-3-1-6-17(9-11)7-2-8-18-10-12(14,15)16/h11H,1-10H2 |
| InChIKey | RDFLLKPMLWESLC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|