C10H18N2O — CID 123960456
1-(3-ethyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanone (PubChem CID 123960456) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-(3-ethyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanone.
| Compound Name | 1-(3-ethyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanone |
|---|---|
| PubChem CID | 123960456 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 1-(3-ethyl-3,8-diazabicyclo[3.2.1]octan-8-yl)ethanone |
| SMILES | CCN1CC2CCC(C1)N2C(C)=O |
| InChI | InChI=1S/C10H18N2O/c1-3-11-6-9-4-5-10(7-11)12(9)8(2)13/h9-10H,3-7H2,1-2H3 |
| InChIKey | QJKGOMFIHJFGNU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |