C8H15IN2 — CID 134516695
3-ethyl-8-iodo-3,8-diazabicyclo[3.2.1]octane (PubChem CID 134516695) has the molecular formula C8H15IN2 and a molecular weight of 266.13 g/mol. Its IUPAC name is 3-ethyl-8-iodo-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 3-ethyl-8-iodo-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 134516695 |
| Molecular Formula | C8H15IN2 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 3-ethyl-8-iodo-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CCN1CC2CCC(C1)N2I |
| InChI | InChI=1S/C8H15IN2/c1-2-10-5-7-3-4-8(6-10)11(7)9/h7-8H,2-6H2,1H3 |
| InChIKey | XYNYNJXRFHGBOJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|