C15H28N2O — CID 155402146
1-[(1S,5R)-3-(5-methylhexyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]ethanone (PubChem CID 155402146) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-[(1S,5R)-3-(5-methylhexyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]ethanone.
| Compound Name | 1-[(1S,5R)-3-(5-methylhexyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]ethanone |
|---|---|
| PubChem CID | 155402146 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1-[(1S,5R)-3-(5-methylhexyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]ethanone |
| SMILES | CC(=O)N1[C@@H]2CC[C@H]1CN(CCCCC(C)C)C2 |
| InChI | InChI=1S/C15H28N2O/c1-12(2)6-4-5-9-16-10-14-7-8-15(11-16)17(14)13(3)18/h12,14-15H,4-11H2,1-3H3/t14-,15+ |
| InChIKey | KAAPHRBSULUTAS-GASCZTMLSA-N |
| XLogP | 2.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|