C16H32N2O — CID 155750957
ethane;1-[(1S,5R)-3-pentyl-3,8-diazabicyclo[3.2.1]octan-8-yl]propan-1-one (PubChem CID 155750957) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is ethane;1-[(1S,5R)-3-pentyl-3,8-diazabicyclo[3.2.1]octan-8-yl]propan-1-one.
| Compound Name | ethane;1-[(1S,5R)-3-pentyl-3,8-diazabicyclo[3.2.1]octan-8-yl]propan-1-one |
|---|---|
| PubChem CID | 155750957 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | ethane;1-[(1S,5R)-3-pentyl-3,8-diazabicyclo[3.2.1]octan-8-yl]propan-1-one |
| SMILES | CC.CCCCCN1C[C@H]2CC[C@@H](C1)N2C(=O)CC |
| InChI | InChI=1S/C14H26N2O.C2H6/c1-3-5-6-9-15-10-12-7-8-13(11-15)16(12)14(17)4-2;1-2/h12-13H,3-11H2,1-2H3;1-2H3/t12-,13+; |
| InChIKey | HZJVSRCCTKIALC-OEEJBDNKSA-N |
| XLogP | 3.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|